EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22N2O2 |
| Net Charge | 0 |
| Average Mass | 286.375 |
| Monoisotopic Mass | 286.16813 |
| SMILES | COC12C[C@@H](CO)CN(C)C1Cc1cnc3cccc2c13 |
| InChI | InChI=1S/C17H22N2O2/c1-19-9-11(10-20)7-17(21-2)13-4-3-5-14-16(13)12(8-18-14)6-15(17)19/h3-5,8,11,15,18,20H,6-7,9-10H2,1-2H3/t11-,15?,17?/m1/s1 |
| InChIKey | JGQZSBLQHCTAJF-NFXPUDJFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-alpha-methoxy-9,10-dihydrolysergol (CHEBI:178696) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| [(9R)-10a-methoxy-7-methyl-4,6,6a,8,9,10-hexahydroindolo[4,3-g]quinolin-9-yl]methanol |
| Manual Xrefs | Databases |
|---|---|
| 35031828 | ChemSpider |
| HMDB0060995 | HMDB |