EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O4 |
| Net Charge | 0 |
| Average Mass | 430.629 |
| Monoisotopic Mass | 430.30831 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)C[C@@H]3C[C@@](C)(O)[C@H](O)O3)[C@@]1(C)CCC/C2=C\C=C1/C[C@H](O)CCC1=C |
| InChI | InChI=1S/C27H42O4/c1-17-7-10-21(28)15-20(17)9-8-19-6-5-13-26(3)23(11-12-24(19)26)18(2)14-22-16-27(4,30)25(29)31-22/h8-9,18,21-25,28-30H,1,5-7,10-16H2,2-4H3/b19-8+,20-9+/t18-,21-,22-,23-,24+,25-,26-,27-/m1/s1 |
| InChIKey | SFOPTSUKUQDFIB-LSTZBGQISA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 25-Hydroxyvitamin D3-26,23-lactol (CHEBI:178587) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (2R,3R,5R)-5-[(2R)-2-[(1R,3aS,4E,7aR)-4-[(2E)-2-[(5R)-5-hydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]propyl]-3-methyloxolane-2,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 30778542 | ChemSpider |
| HMDB0060127 | HMDB |