EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32N6O12S2 |
| Net Charge | 0 |
| Average Mass | 612.640 |
| Monoisotopic Mass | 612.15196 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)NCC(=O)O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H32N6O12S2/c21-9(19(35)36)1-3-13(27)25-11(17(33)23-5-15(29)30)7-39-40-8-12(18(34)24-6-16(31)32)26-14(28)4-2-10(22)20(37)38/h9-12H,1-8,21-22H2,(H,23,33)(H,24,34)(H,25,27)(H,26,28)(H,29,30)(H,31,32)(H,35,36)(H,37,38)/t9-,10-,11-,12-/m0/s1 |
| InChIKey | YPZRWBKMTBYPTK-BJDJZHNGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glutathione disulfide (CHEBI:17858) has role Escherichia coli metabolite (CHEBI:76971) |
| glutathione disulfide (CHEBI:17858) has role antineoplastic agent (CHEBI:35610) |
| glutathione disulfide (CHEBI:17858) has role mouse metabolite (CHEBI:75771) |
| glutathione disulfide (CHEBI:17858) is a glutathione derivative (CHEBI:24337) |
| glutathione disulfide (CHEBI:17858) is a organic disulfide (CHEBI:35489) |
| glutathione disulfide (CHEBI:17858) is conjugate acid of glutathione disulfide(2−) (CHEBI:58297) |
| Incoming Relation(s) |
| glutathione disulfide(2−) (CHEBI:58297) is conjugate base of glutathione disulfide (CHEBI:17858) |
| IUPAC Name |
|---|
| (2S,2'S)-5,5'-[disulfanediylbis({(2R)-3-[(carboxymethyl)amino]-3-oxopropane-1,2-diyl}imino)]bis(2-amino-5-oxopentanoic acid) |
| INN | Source |
|---|---|
| oxiglutationa | WHO MedNet |
| Synonyms | Source |
|---|---|
| Glutathione disulfide | KEGG COMPOUND |
| glutathione disulphide | ChemIDplus |
| GSSG | KEGG COMPOUND |
| oxidised glutathione | ChEBI |
| Oxidized glutathione | KEGG COMPOUND |
| Oxidized glutathione | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Oxiglutatione component of navstel | ChEMBL |
| Citations |
|---|