EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O4 |
| Net Charge | 0 |
| Average Mass | 446.672 |
| Monoisotopic Mass | 446.33961 |
| SMILES | [H][C@]1([C@@](C)(O)CCCCC(C)(C)O)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](O)C[C@H](O)C3=C)CCC[C@]12C |
| InChI | InChI=1S/C28H46O4/c1-19-21(17-22(29)18-24(19)30)11-10-20-9-8-15-27(4)23(20)12-13-25(27)28(5,32)16-7-6-14-26(2,3)31/h10-11,22-25,29-32H,1,6-9,12-18H2,2-5H3/b20-10+,21-11-/t22-,23+,24+,25+,27+,28+/m1/s1 |
| InChIKey | ZGTCTEBBFVUQEB-JYUOZGIFSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20S)-1alpha,20,25-trihydroxy-24a-homovitamin D3 / (20S)-1alpha,20,25-trihydroxy-24a-homocholecalciferol (CHEBI:178547) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,3S,5Z)-5-[(2E)-2-[(1S,3aS,7aS)-1-[(2S)-2,7-dihydroxy-7-methyloctan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 7826438 | ChemSpider |
| LMST03020387 | LIPID MAPS |