EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O4 |
| Net Charge | 0 |
| Average Mass | 446.672 |
| Monoisotopic Mass | 446.33961 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCCC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)[C@@H](OC)[C@H](O)C1=C |
| InChI | InChI=1S/C28H46O4/c1-18(9-7-15-27(3,4)31)22-13-14-23-20(10-8-16-28(22,23)5)11-12-21-17-24(29)26(32-6)25(30)19(21)2/h11-12,18,22-26,29-31H,2,7-10,13-17H2,1,3-6H3/b20-11+,21-12-/t18-,22-,23+,24-,25-,26-,28-/m1/s1 |
| InChIKey | IYVWHAHWFGFFIF-ZWBLGGIOSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2beta-methoxy-1alpha,25-dihydroxyvitamin D3 (CHEBI:178538) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1R,2R,3R,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-2-methoxy-4-methylidenecyclohexane-1,3-diol |
| Manual Xrefs | Databases |
|---|---|
| 7826635 | ChemSpider |
| LMST03020603 | LIPID MAPS |