EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H46O4 |
| Net Charge | 0 |
| Average Mass | 446.672 |
| Monoisotopic Mass | 446.33961 |
| SMILES | [H][C@@]12CC[C@]([H])([C@@H](C)OCCCCC(C)(C)O)[C@@]1(C)CCC/C2=C\C=C1/C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C28H46O4/c1-19-22(17-23(29)18-26(19)30)11-10-21-9-8-15-28(5)24(12-13-25(21)28)20(2)32-16-7-6-14-27(3,4)31/h10-11,20,23-26,29-31H,1,6-9,12-18H2,2-5H3/b21-10+,22-11+/t20-,23-,24-,25+,26+,28-/m1/s1 |
| InChIKey | MEJNJVYTSDEKIO-HZUHCLFRSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| KH 1049 (CHEBI:178537) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (1S,3R,5E,7E,20R)-20-[(5-hydroxy-5-methylhexyl)oxy]-9,10-secopregna-5,7,10-triene-1,3-diol |
| Synonyms | Source |
|---|---|
| KH1049 | ChEBI |
| KH-1049 | ChEBI |
| (5E,7E)-(1S,3R,20R)-22-oxa-24a,24b-dihomo-9,10-seco-5,7,10(19)-cholestatriene-1,3,25-triol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST03060004 | LIPID MAPS |
| Citations |
|---|