EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H21NO4 |
| Net Charge | 0 |
| Average Mass | 339.391 |
| Monoisotopic Mass | 339.14706 |
| SMILES | COc1cc2c(ccc3c4c(c(O)c(OC)c32)CN(C)CC4)cc1O |
| InChI | InChI=1S/C20H21NO4/c1-21-7-6-12-13-5-4-11-8-16(22)17(24-2)9-14(11)18(13)20(25-3)19(23)15(12)10-21/h4-5,8-9,22-23H,6-7,10H2,1-3H3 |
| InChIKey | QOWFEPGZJDCIKG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Litebamine (CHEBI:178482) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| 9,11-dimethoxy-2-methyl-3,4-dihydro-1H-naphtho[2,1-]isoquinoline-8,12-diol |
| Manual Xrefs | Databases |
|---|---|
| 170528 | ChemSpider |
| HMDB0038629 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:137031-56-2 | ChemIDplus |