EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10O2 |
| Net Charge | 0 |
| Average Mass | 90.122 |
| Monoisotopic Mass | 90.06808 |
| SMILES | COC(C)OC |
| InChI | InChI=1S/C4H10O2/c1-4(5-2)6-3/h4H,1-3H3 |
| InChIKey | SPEUIVXLLWOEMJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,1-dimethoxyethane (CHEBI:178404) has functional parent dimethoxymethane (CHEBI:48341) |
| 1,1-dimethoxyethane (CHEBI:178404) has role flavouring agent (CHEBI:35617) |
| 1,1-dimethoxyethane (CHEBI:178404) has role plant metabolite (CHEBI:76924) |
| 1,1-dimethoxyethane (CHEBI:178404) is a acetal (CHEBI:59769) |
| 1,1-dimethoxyethane (CHEBI:178404) is a diether (CHEBI:46786) |
| IUPAC Name |
|---|
| 1,1-dimethoxyethane |
| Synonyms | Source |
|---|---|
| 3-methyl-2,4-dioxapentane | NIST Chemistry WebBook |
| acetaldehyde dimethyl acetal | ChEBI |
| acetaldehyde methyl acetal | NIST Chemistry WebBook |
| dimethyl acetal | NIST Chemistry WebBook |
| ethylidene dimethyl ether | NIST Chemistry WebBook |
| FEMA 3426 | ChEBI |
| Citations |
|---|