EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H5NO5 |
| Net Charge | -2 |
| Average Mass | 147.086 |
| Monoisotopic Mass | 147.01787 |
| SMILES | N[C@H](C(=O)[O-])[C@H](O)C(=O)[O-] |
| InChI | InChI=1S/C4H7NO5/c5-1(3(7)8)2(6)4(9)10/h1-2,6H,5H2,(H,7,8)(H,9,10)/p-2/t1-,2-/m0/s1 |
| InChIKey | YYLQUHNPNCGKJQ-LWMBPPNESA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-L-aspartate(2−) (CHEBI:17838) has functional parent L-aspartate(2−) (CHEBI:29993) |
| (3S)-3-hydroxy-L-aspartate(2−) (CHEBI:17838) is a C4-dicarboxylate (CHEBI:61336) |
| (3S)-3-hydroxy-L-aspartate(2−) (CHEBI:17838) is conjugate base of (3S)-3-hydroxy-L-aspartic acid (CHEBI:10696) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-L-aspartic acid (CHEBI:10696) is conjugate acid of (3S)-3-hydroxy-L-aspartate(2−) (CHEBI:17838) |
| IUPAC Names |
|---|
| (2S,3S)-2-amino-3-hydroxybutanedioate |
| (3S)-3-hydroxy-L-aspartate |