EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H13NO4 |
| Net Charge | 0 |
| Average Mass | 175.184 |
| Monoisotopic Mass | 175.08446 |
| SMILES | [H][C@]12C[C@H](O)[C@](O)(N1)[C@H](O)C[C@@H]2O |
| InChI | InChI=1S/C7H13NO4/c9-4-2-6(11)7(12)5(10)1-3(4)8-7/h3-6,8-12H,1-2H2/t3-,4+,5+,6-,7-/m1/s1 |
| InChIKey | DJTRTWALNSXKOG-VOQCIKJUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Calystegine B5 (CHEBI:178343) is a tropane alkaloid (CHEBI:37332) |
| IUPAC Name |
|---|
| (1R,2R,4S,5R,7S)-8-azabicyclo[3.2.1]octane-1,2,4,7-tetrol |
| Manual Xrefs | Databases |
|---|---|
| 57583181 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:197565-91-6 | ChemIDplus |