EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H15NO4 |
| Net Charge | 0 |
| Average Mass | 189.211 |
| Monoisotopic Mass | 189.10011 |
| SMILES | CC(C)C(NC(=O)[C@H](C)O)C(=O)O |
| InChI | InChI=1S/C8H15NO4/c1-4(2)6(8(12)13)9-7(11)5(3)10/h4-6,10H,1-3H3,(H,9,11)(H,12,13)/t5-,6?/m0/s1 |
| InChIKey | IJKKTQLUXOILBQ-ZBHICJROSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-lactoyl-Valine (CHEBI:178214) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-[[(2S)-2-hydroxypropanoyl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 59664336 | ChemSpider |
| HMDB0062181 | HMDB |