EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H3O2 |
| Net Charge | -1 |
| Average Mass | 83.066 |
| Monoisotopic Mass | 83.01385 |
| SMILES | CC#CC(=O)[O-] |
| InChI | InChI=1S/C4H4O2/c1-2-3-4(5)6/h1H3,(H,5,6)/p-1 |
| InChIKey | LUEHNHVFDCZTGL-UHFFFAOYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | cervical mucus (BTO:0000242) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Butynoate (CHEBI:178200) is a straight-chain fatty acid (CHEBI:59202) |
| IUPAC Name |
|---|
| but-2-ynoate |
| Manual Xrefs | Databases |
|---|---|
| 5362516 | ChemSpider |