EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12ClNO |
| Net Charge | 0 |
| Average Mass | 269.731 |
| Monoisotopic Mass | 269.06074 |
| SMILES | [H]C(=O)c1cn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C16H12ClNO/c17-14-7-5-12(6-8-14)9-18-10-13(11-19)15-3-1-2-4-16(15)18/h1-8,10-11H,9H2 |
| InChIKey | ZDRQMXCSSAPUMM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oncrasin-1 (CHEBI:178196) has role antineoplastic agent (CHEBI:35610) |
| oncrasin-1 (CHEBI:178196) has role apoptosis inducer (CHEBI:68495) |
| oncrasin-1 (CHEBI:178196) is a arenecarbaldehyde (CHEBI:33855) |
| oncrasin-1 (CHEBI:178196) is a indoles (CHEBI:24828) |
| oncrasin-1 (CHEBI:178196) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 1-(4-chlorobenzyl)-1H-indole-3-carbaldehyde |
| Synonyms | Source |
|---|---|
| 1-[(4-chlorophenyl)methyl]-1H-indole-3-carbaldehyde | IUPAC |
| oncrasin 1 | ChEBI |
| ONC-1 | ChEBI |
| 1-(p-chlorobenzyl)-1H-indole-3-carbaldehyde | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US2009286847 | Patent |
| 761753 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:75629-57-1 | ChEBI |
| Citations |
|---|