EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H19NO4 |
| Net Charge | 0 |
| Average Mass | 313.353 |
| Monoisotopic Mass | 313.13141 |
| SMILES | COc1cc(/C=C/C(=O)NCCc2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+ |
| InChIKey | NPNNKDMSXVRADT-WEVVVXLNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| Piper boehmeriaefolium (ncbitaxon:130389) | whole plant (BTO:0001461) | PubMed (21158422) | Methanolic extract of air-dried, powdered whole plant |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-feruloyltyramine (CHEBI:17818) has role metabolite (CHEBI:25212) |
| N-feruloyltyramine (CHEBI:17818) is a tyramines (CHEBI:27175) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
| Synonyms | Source |
|---|---|
| N-Feruloyltyramine | KEGG COMPOUND |
| Moupinamide | ChemIDplus |
| trans-N-Feruloyltyramine | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| N-[(E)-feruloyl]tyramine | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:65646-26-6 | ChemIDplus |
| CAS:66648-43-9 | KEGG COMPOUND |