EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H17N7O6 |
| Net Charge | 0 |
| Average Mass | 331.289 |
| Monoisotopic Mass | 331.12403 |
| SMILES | NC1=NC2C(COC(=O)NO)[N+]([O-])=C(N)N3CCC(O)(O)C23N1 |
| InChI | InChI=1S/C10H17N7O6/c11-6-13-5-4(3-23-8(18)15-21)17(22)7(12)16-2-1-9(19,20)10(5,16)14-6/h4-5,19-21H,1-3,12H2,(H,15,18)(H3,11,13,14) |
| InChIKey | PTHGRTJYAZWBTI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| Roles Classification |
|---|
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N'-Hydroxyneosaxitoxin (CHEBI:178170) has role marine metabolite (CHEBI:76507) |
| N'-Hydroxyneosaxitoxin (CHEBI:178170) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| (2,6-diamino-10,10-dihydroxy-5-oxido-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-5-ium-4-yl)methyl N-hydroxycarbamate |