EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:178169 - Na,Na-Dimethylhistamine
| Formula | C7H13N3 |
| Net Charge | 0 |
| Average Mass | 139.202 |
| Monoisotopic Mass | 139.11095 |
| SMILES | CN(C)CCc1cncn1 |
| InChI | InChI=1S/C7H13N3/c1-10(2)4-3-7-5-8-6-9-7/h5-6H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | ZJDIMSMQXMWMCF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Na,Na-Dimethylhistamine (CHEBI:178169) is a aralkylamine (CHEBI:18000) |
| IUPAC Name |
|---|
| 2-(1H-imidazol-5-yl)-N,N-dimethylethanamine |
| Manual Xrefs | Databases |
|---|---|
| 12135 | ChemSpider |
| HMDB0033438 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:673-46-1 | ChemIDplus |