EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27NO11 |
| Net Charge | 0 |
| Average Mass | 457.432 |
| Monoisotopic Mass | 457.15841 |
| SMILES | N#CC(OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O)c1ccccc1 |
| InChI | InChI=1S/C20H27NO11/c21-6-10(9-4-2-1-3-5-9)29-20-18(16(27)14(25)12(8-23)31-20)32-19-17(28)15(26)13(24)11(7-22)30-19/h1-5,10-20,22-28H,7-8H2 |
| InChIKey | YGHHWSRCTPQFFC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mandelonitrile sophoroside (CHEBI:178160) is a cyanogenic glycoside (CHEBI:23436) |
| IUPAC Name |
|---|
| 2-[4,5-dihydroxy-6-(hydroxymethyl)-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-phenylacetonitrile |
| Manual Xrefs | Databases |
|---|---|
| HMDB0038475 | HMDB |