EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H26O17 |
| Net Charge | 0 |
| Average Mass | 694.554 |
| Monoisotopic Mass | 694.11700 |
| SMILES | O=C1OCC2O[C@@H](Oc3cc(O)c(C(=O)c4ccccc4)c(O)c3)[C@H](O)[C@@H](O)C2OC(=O)c2cc(O)c(O)c(O)c2-c2c1cc(O)c(O)c2O |
| InChI | InChI=1S/C33H26O17/c34-15-6-12(7-16(35)22(15)23(38)11-4-2-1-3-5-11)48-33-29(44)28(43)30-19(49-33)10-47-31(45)13-8-17(36)24(39)26(41)20(13)21-14(32(46)50-30)9-18(37)25(40)27(21)42/h1-9,19,28-30,33-37,39-44H,10H2/t19?,28-,29-,30?,33-/m1/s1 |
| InChIKey | RPZNIDVYYGUDPA-JRFUOTGDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Guavin B (CHEBI:178153) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| (11R,12R,13S)-13-(4-benzoyl-3,5-dihydroxyphenoxy)-3,4,5,11,12,21,22,23-octahydroxy-9,14,17-trioxatetracyclo[17.4.0.02,7.010,15]tricosa-1(23),2,4,6,19,21-hexaene-8,18-dione |
| Manual Xrefs | Databases |
|---|---|
| 152995 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:94530-90-2 | ChemIDplus |