EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21NO4 |
| Net Charge | 0 |
| Average Mass | 363.413 |
| Monoisotopic Mass | 363.14706 |
| SMILES | COc1ccc2c(c1OC)C(C)N(C)c1c-2ccc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C22H21NO4/c1-12-20-14(7-8-17(24-3)22(20)25-4)15-6-5-13-9-18-19(27-11-26-18)10-16(13)21(15)23(12)2/h5-10,12H,11H2,1-4H3 |
| InChIKey | NDRJOHZGHCUTCQ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-Methyldihydrochelerythrine (CHEBI:178142) is a benzophenanthridine alkaloid (CHEBI:38517) |
| IUPAC Name |
|---|
| 1,2-dimethoxy-12,13-dimethyl-13H-[1,3]benzodioxolo[5,6-c]phenanthridine |
| Manual Xrefs | Databases |
|---|---|
| 35015115 | ChemSpider |
| HMDB0041143 | HMDB |