EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO4 |
| Net Charge | 0 |
| Average Mass | 195.174 |
| Monoisotopic Mass | 195.05316 |
| SMILES | NC(C(=O)O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H9NO4/c10-7(9(13)14)5-1-3-6(4-2-5)8(11)12/h1-4,7H,10H2,(H,11,12)(H,13,14) |
| InChIKey | VTMJKPGFERYGJF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Carboxyphenylglycine (CHEBI:178134) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 4-[amino(carboxy)methyl]benzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4934 | ChemSpider |
| HMDB0002016 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:7292-81-1 | ChemIDplus |