EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2S |
| Net Charge | 0 |
| Average Mass | 140.211 |
| Monoisotopic Mass | 140.04082 |
| SMILES | CSc1nccnc1C |
| InChI | InChI=1S/C6H8N2S/c1-5-6(9-2)8-4-3-7-5/h3-4H,1-2H3 |
| InChIKey | PPPFFGVGWFKTHX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyl-(3 or 5 or 6)-(methylthio)pyrazine (mixture of isomers) (CHEBI:178124) is a aryl sulfide (CHEBI:35683) |
| IUPAC Name |
|---|
| 2-methyl-3-methylsulanylpyrazine |
| Manual Xrefs | Databases |
|---|---|
| 68636 | ChemSpider |
| HMDB0032384 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2882-20-4 | ChemIDplus |