EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19NO9S3 |
| Net Charge | 0 |
| Average Mass | 393.461 |
| Monoisotopic Mass | 393.02219 |
| SMILES | CSCC/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C10H19NO9S3/c1-21-3-2-6(11-20-23(16,17)18)22-10-9(15)8(14)7(13)5(4-12)19-10/h5,7-10,12-15H,2-4H2,1H3,(H,16,17,18)/b11-6+ |
| InChIKey | ZQKUEDRZCDZXIY-IZZDOVSWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(Methylthio)ethyl glucosinolate (CHEBI:178120) is a alkylglucosinolate (CHEBI:36445) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] (1E)-3-methylsulanyl-N-sulooxypropanimidothioate |
| Manual Xrefs | Databases |
|---|---|
| 35014567 | ChemSpider |
| HMDB0038408 | HMDB |