EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO5 |
| Net Charge | 0 |
| Average Mass | 199.162 |
| Monoisotopic Mass | 199.04807 |
| SMILES | NC(Cc1cocc1C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H9NO5/c9-6(8(12)13)1-4-2-14-3-5(4)7(10)11/h2-3,6H,1,9H2,(H,10,11)(H,12,13) |
| InChIKey | XZTCUENJMGJQGJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arisaema erubescens (ncbitaxon:228806) | bulb (BTO:0000159) | MetaboLights (MTBLS2858) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-alpha-Amino-4-carboxy-3-furanpropanoic acid (CHEBI:178114) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| 4-(2-amino-2-carboxyethyl)uran-3-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 35032867 | ChemSpider |
| HMDB0029414 | HMDB |