EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O |
| Net Charge | 0 |
| Average Mass | 252.442 |
| Monoisotopic Mass | 252.24532 |
| SMILES | [H]C(=O)CCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C17H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18/h9-10,17H,2-8,11-16H2,1H3/b10-9+ |
| InChIKey | UZXKSNXOPFPOKK-MDZDMXLPSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8E)-heptadecenal (CHEBI:178111) is a 8-heptadecenal (CHEBI:168594) |
| IUPAC Name |
|---|
| (8E)-heptadec-8-enal |
| Synonyms | Source |
|---|---|
| (8E)-8-heptadecenal | ChEBI |
| (E)-8-heptadecenal | ChEBI |
| (E)-heptadec-8-enal | ChEBI |
| trans-8-heptadecenal | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 16380355 | ChemSpider |
| HMDB0041335 | HMDB |
| LMFA06000259 | LIPID MAPS |