EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35O8 |
| Net Charge | -1 |
| Average Mass | 463.547 |
| Monoisotopic Mass | 463.23374 |
| SMILES | [H][C@@]12CC=C3C[C@@H](O[C@@H]4O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]4O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C(=O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H36O8/c1-24-9-7-13(32-23-20(29)18(27)19(28)21(33-23)22(30)31)11-12(24)3-4-14-15-5-6-17(26)25(15,2)10-8-16(14)24/h3,13-16,18-21,23,27-29H,4-11H2,1-2H3,(H,30,31)/p-1/t13-,14-,15-,16-,18-,19-,20+,21-,23+,24-,25-/m0/s1 |
| InChIKey | GLONBVCUAVPJFV-PCDHEYSGSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dehydroepiandrosterone 3-O-(β-D-glucuronide)(1−) (CHEBI:178105) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| dehydroepiandrosterone 3-O-(β-D-glucuronide)(1−) (CHEBI:178105) is conjugate base of dehydroisoandrosterone 3-glucuronide (CHEBI:68834) |
| Incoming Relation(s) |
| dehydroisoandrosterone 3-glucuronide (CHEBI:68834) is conjugate acid of dehydroepiandrosterone 3-O-(β-D-glucuronide)(1−) (CHEBI:178105) |
| UniProt Name | Source |
|---|---|
| 3β-androst-5-en-17-one 3-O-(β-D-glucuronate) | UniProt |
| Citations |
|---|