EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C[13C4]H6O5 |
| Net Charge | 0 |
| Average Mass | 150.067 |
| Monoisotopic Mass | 150.03494 |
| SMILES | O=C(O)[13CH2][13CH2][13C](=O)[13C](=O)O |
| InChI | InChI=1S/C5H6O5/c6-3(5(9)10)1-2-4(7)8/h1-2H2,(H,7,8)(H,9,10)/i1+1,2+1,3+1,5+1 |
| InChIKey | KPGXRSRHYNQIFN-SAXDBNRNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alpha-ketoglutaric acid-13C4 (CHEBI:178083) is a 13C-modified compound (CHEBI:139357) |
| alpha-ketoglutaric acid-13C4 (CHEBI:178083) is a dicarboxylic acid (CHEBI:35692) |
| alpha-ketoglutaric acid-13C4 (CHEBI:178083) is conjugate acid of alpha-ketoglutarate-13C4 (CHEBI:178058) |
| Incoming Relation(s) |
| alpha-ketoglutarate-13C4 (CHEBI:178058) is conjugate base of alpha-ketoglutaric acid-13C4 (CHEBI:178083) |