EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:178077 - Hydroxymyristate
| Formula | C14H28O3 |
| Net Charge | 0 |
| Average Mass | 244.375 |
| Monoisotopic Mass | 244.20384 |
| SMILES | CCCCCCCCCCCCCC(=O)OO |
| InChI | InChI=1S/C14H28O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)17-16/h16H,2-13H2,1H3 |
| InChIKey | GWUNZLSWZMWKSN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2187) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxymyristate (CHEBI:178077) is a peroxy acid (CHEBI:52094) |
| IUPAC Name |
|---|
| tetradecaneperoxoic acid |
| Manual Xrefs | Databases |
|---|---|
| 124016 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:19816-73-0 | ChemIDplus |