EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | [13C9]H8O4 |
| Net Charge | 0 |
| Average Mass | 189.090 |
| Monoisotopic Mass | 189.07245 |
| SMILES | O=[13C](O)/[13CH]=[13CH]/[13c]1[13cH][13cH][13c](O)[13c](O)[13cH]1 |
| InChI | InChI=1S/C9H8O4/c10-7-3-1-6(5-8(7)11)2-4-9(12)13/h1-5,10-11H,(H,12,13)/b4-2+/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1 |
| InChIKey | QAIPRVGONGVQAS-RJKLISAOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2187) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Caffeic Acid-13C9 (CHEBI:178076) is a 13C-modified compound (CHEBI:139357) |
| Caffeic Acid-13C9 (CHEBI:178076) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| (E)-3-(3,4-dihydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)(1,2,3-13C3)prop-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 49071963 | ChemSpider |