EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23NO7 |
| Net Charge | 0 |
| Average Mass | 293.316 |
| Monoisotopic Mass | 293.14745 |
| SMILES | CC[C@H](C)[C@H](NC1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C12H23NO7/c1-3-6(2)8(11(18)19)13-12(5-15)10(17)9(16)7(4-14)20-12/h6-10,13-17H,3-5H2,1-2H3,(H,18,19)/t6-,7+,8-,9+,10-,12?/m0/s1 |
| InChIKey | PJDOVJGKERKCDL-OEEOIEHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2187) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fructosyl isoleucine (CHEBI:178073) is a glyco-amino acid (CHEBI:35258) |
| IUPAC Name |
|---|
| (2S,3S)-2-[[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]amino]-3-methylpentanoic acid |