EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21NO7 |
| Net Charge | 0 |
| Average Mass | 279.289 |
| Monoisotopic Mass | 279.13180 |
| SMILES | CC(C)[C@H](NC1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O)C(=O)O |
| InChI | InChI=1S/C11H21NO7/c1-5(2)7(10(17)18)12-11(4-14)9(16)8(15)6(3-13)19-11/h5-9,12-16H,3-4H2,1-2H3,(H,17,18)/t6-,7+,8-,9+,11?/m1/s1 |
| InChIKey | KVUAQCKXYIJBCP-BUFOXMIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2187) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fructosyl valine (CHEBI:178071) is a glyco-amino acid (CHEBI:35258) |
| IUPAC Name |
|---|
| (2S)-2-[[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]amino]-3-methylbutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29433473 | ChemSpider |