EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12[13C4]H32O2 |
| Net Charge | 0 |
| Average Mass | 260.399 |
| Monoisotopic Mass | 260.25365 |
| SMILES | CCCCCCCCCCCC[13CH2][13CH2][13CH2][13C](=O)O |
| InChI | InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18)/i13+1,14+1,15+1,16+1 |
| InChIKey | IPCSVZSSVZVIGE-FIZPRHLTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2187) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexadecanoic acid-13C4 (CHEBI:178060) is a 13C-modified compound (CHEBI:139357) |
| hexadecanoic acid-13C4 (CHEBI:178060) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (1,2,3,4-13C4)hexadecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 17341155 | ChemSpider |