EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11[13C3]H28O2 |
| Net Charge | 0 |
| Average Mass | 231.353 |
| Monoisotopic Mass | 231.21899 |
| SMILES | CCCCCCCCCCC[13CH2][13CH2][13C](=O)O |
| InChI | InChI=1S/C14H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16/h2-13H2,1H3,(H,15,16)/i12+1,13+1,14+1 |
| InChIKey | TUNFSRHWOTWDNC-WEQCDQLKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS2187) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| myristic acid-13C3 (CHEBI:178059) is a 13C-modified compound (CHEBI:139357) |
| myristic acid-13C3 (CHEBI:178059) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (1,2,3-13C3)tetradecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 57267812 | ChemSpider |