EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40O3 |
| Net Charge | 0 |
| Average Mass | 388.592 |
| Monoisotopic Mass | 388.29775 |
| SMILES | [H][C@@]12CC[C@H](OCCCC(C)C)[C@@]1(C)CCC/C2=C\C=C1\C[C@@H](O)C[C@H](O)C1=C |
| InChI | InChI=1S/C25H40O3/c1-17(2)7-6-14-28-24-12-11-22-19(8-5-13-25(22,24)4)9-10-20-15-21(26)16-23(27)18(20)3/h9-10,17,21-24,26-27H,3,5-8,11-16H2,1-2,4H3/b19-9+,20-10-/t21-,22+,23+,24+,25+/m1/s1 |
| InChIKey | QWGDZWGWMIPRQO-CFNSAOOPSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1alpha-Hydroxy-21-nor-20-oxavitamin D3 (CHEBI:178015) is a vitamin D (CHEBI:27300) |
| Manual Xrefs | Databases |
|---|---|
| LMST03020026 | LIPID MAPS |