EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H5N5O3 |
| Net Charge | 0 |
| Average Mass | 195.138 |
| Monoisotopic Mass | 195.03924 |
| SMILES | Nc1nc(=O)c2nc(=O)c(=O)nc2n1 |
| InChI | InChI=1S/C6H5N5O3/c7-6-10-2-1(3(12)11-6)8-4(13)5(14)9-2/h(H,8,13)(H4,7,9,10,11,12,14) |
| InChIKey | SFLOGVVDXPCWGR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Libytheana carinenta bachmanii (ncbitaxon:1178125) | - | PubMed (24302393) | Found in wings. Species also known as Libytheana bachmanii. |
| Pieris rapae (ncbitaxon:64459) | - | PubMed (17669418) | Found in wings. |
| Sturnus vulgaris (ncbitaxon:9172) | - | PubMed (7781036) |
| Roles Classification |
|---|
| Biological Roles: | biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| leucopterin (keto form) (CHEBI:178010) has role animal metabolite (CHEBI:75767) |
| leucopterin (keto form) (CHEBI:178010) has role biological pigment (CHEBI:26130) |
| leucopterin (keto form) (CHEBI:178010) is a pterins (CHEBI:26375) |
| leucopterin (keto form) (CHEBI:178010) is tautomer of leucopterin (enol form) (CHEBI:178109) |
| Incoming Relation(s) |
| leucopterin (enol form) (CHEBI:178109) is tautomer of leucopterin (keto form) (CHEBI:178010) |
| IUPAC Name |
|---|
| 2-amino-5,8-dihydropteridine-4,6,7(3H)-trione |
| Synonyms | Source |
|---|---|
| 2-amino-5,8-dihydro-4,6,7(3H)-pteridinetrione | ChEBI |
| leikopterin | ChemIDplus |
| leucopterin | ChemIDplus |
| leukopterin | ChemIDplus |
| Citations |
|---|