EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O6 |
| Net Charge | 0 |
| Average Mass | 176.124 |
| Monoisotopic Mass | 176.03209 |
| SMILES | CC(O)(CC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O6/c1-6(12,5(10)11)2-3(7)4(8)9/h12H,2H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | YRWAMSXHYBBHFL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-4-methyl-2-oxoglutaric acid (CHEBI:17801) has functional parent glutaric acid (CHEBI:17859) |
| 4-hydroxy-4-methyl-2-oxoglutaric acid (CHEBI:17801) is a oxo dicarboxylic acid (CHEBI:36145) |
| 4-hydroxy-4-methyl-2-oxoglutaric acid (CHEBI:17801) is a tertiary alcohol (CHEBI:26878) |
| 4-hydroxy-4-methyl-2-oxoglutaric acid (CHEBI:17801) is conjugate acid of 4-hydroxy-4-methyl-2-oxoglutarate(2−) (CHEBI:58276) |
| Incoming Relation(s) |
| 4-hydroxy-4-methyl-2-oxoglutarate(2−) (CHEBI:58276) is conjugate base of 4-hydroxy-4-methyl-2-oxoglutaric acid (CHEBI:17801) |
| IUPAC Name |
|---|
| 2-hydroxy-2-methyl-4-oxopentanedioic acid |
| Synonyms | Source |
|---|---|
| 2-keto-4-hydroxy-4-methylglutaric acid | ChEBI |
| γ-hydroxy-γ-methyl-α-ketoglutaric acid | ChEBI |
| parapyruvic acid | ChEBI |
| 4-hydroxy-4-methyl-2-oxoglutaric acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C06033 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:19071-44-4 | Beilstein |
| Citations |
|---|