EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO4 |
| Net Charge | 0 |
| Average Mass | 223.228 |
| Monoisotopic Mass | 223.08446 |
| SMILES | O=C(CCc1ccccc1)NC(O)C(=O)O |
| InChI | InChI=1S/C11H13NO4/c13-9(12-10(14)11(15)16)7-6-8-4-2-1-3-5-8/h1-5,10,14H,6-7H2,(H,12,13)(H,15,16) |
| InChIKey | LGQPWAWSLIEESE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | hemolymph (BTO:0000572) | MetaboLights (MTBLS3247) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyphenylpropionylglycine (CHEBI:177996) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-hydroxy-2-(3-phenylpropanoylamino)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 74849634 | ChemSpider |
| HMDB0094723 | HMDB |