EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O6 |
| Net Charge | 0 |
| Average Mass | 286.239 |
| Monoisotopic Mass | 286.04774 |
| SMILES | O=C1C=C(O)C(C(=O)/C=C/c2ccc(O)cc2)=C(O)C1=O |
| InChI | InChI=1S/C15H10O6/c16-9-4-1-8(2-5-9)3-6-10(17)13-11(18)7-12(19)14(20)15(13)21/h1-7,16,18,21H/b6-3+ |
| InChIKey | ZWTHNQBQIXDGOG-ZZXKWVIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | hemolymph (BTO:0000572) | MetaboLights (MTBLS3247) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dihydroxy-2-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]cyclohexa-2,5-diene-1,4-dione (CHEBI:177983) is a hydroxycinnamic acid (CHEBI:24689) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-4-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]cyclohexa-3,5-diene-1,2-dione |