EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O |
| Net Charge | 0 |
| Average Mass | 192.302 |
| Monoisotopic Mass | 192.15142 |
| SMILES | CC1C(O)C=C2C(C)(C)CC=CC21C |
| InChI | InChI=1S/C13H20O/c1-9-10(14)8-11-12(2,3)6-5-7-13(9,11)4/h5,7-10,14H,6H2,1-4H3 |
| InChIKey | MHUYBIUXLMLCJM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | hemolymph (BTO:0000572) | MetaboLights (MTBLS3247) |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,4,4,7a-tetramethyl-2,4,5,7a-tetrahydro-1H-inden-2-ol (CHEBI:177980) has role flavouring agent (CHEBI:35617) |
| 1,4,4,7a-tetramethyl-2,4,5,7a-tetrahydro-1H-inden-2-ol (CHEBI:177980) is a indene (CHEBI:37910) |
| 1,4,4,7a-tetramethyl-2,4,5,7a-tetrahydro-1H-inden-2-ol (CHEBI:177980) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| 1,4,4,7a-tetramethyl-2,4,5,7a-tetrahydro-1H-inden-2-ol |
| Synonyms | Source |
|---|---|
| 1,4,4,7a-tetramethyl-2,5-dihydro-1H-inden-2-ol | SUBMITTER |
| FEMA 4521 | ChEBI |
| 2,2,6,7-tetramethylbicyclo[4.3.0]nona-4,9(1)-dien-8-ol | ChEBI |
| 2,4,5,7a-tetrahydro-1,4,4,7a-tetramethyl-1H-inden-2-ol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036684 | HMDB |
| 35014199 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:37847595 | Reaxys |
| CAS:97866-86-9 | ChEBI |