EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | Cc1c(/C=C/C(=O)O)oc(CCC(=O)O)c1C |
| InChI | InChI=1S/C12H14O5/c1-7-8(2)10(4-6-12(15)16)17-9(7)3-5-11(13)14/h3,5H,4,6H2,1-2H3,(H,13,14)(H,15,16)/b5-3+ |
| InChIKey | CPSCLNDMBZOUQX-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | hemolymph (BTO:0000572) | MetaboLights (MTBLS3247) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethyl-5-carboxyethyl-2-furanacrylic acid (CHEBI:177978) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 3-[5-[(E)-2-carboxyethenyl]-3,4-dimethyluran-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA01150051 | LIPID MAPS |