EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22O2 |
| Net Charge | 0 |
| Average Mass | 210.317 |
| Monoisotopic Mass | 210.16198 |
| SMILES | CCCCCC#CCCCCCC(=O)O |
| InChI | InChI=1S/C13H22O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-5,8-12H2,1H3,(H,14,15) |
| InChIKey | UKKKJMVUWWRRTL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | hemolymph (BTO:0000572) | MetaboLights (MTBLS3247) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Tridecynoic acid (CHEBI:177965) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| tridec-7-ynoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4472146 | ChemSpider |
| LMFA01030600 | LIPID MAPS |