EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O4.2H2O |
| Net Charge | 0 |
| Average Mass | 274.273 |
| Monoisotopic Mass | 274.11649 |
| SMILES | NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O.O.O |
| InChI | InChI=1S/C11H14N2O4.2H2O/c12-6-10(15)13-9(11(16)17)5-7-1-3-8(14)4-2-7;;/h1-4,9,14H,5-6,12H2,(H,13,15)(H,16,17);2*1H2/t9-;;/m0../s1 |
| InChIKey | VELZBUAWAUZDLF-WWPIYYJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | hemolymph (BTO:0000572) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glycyl tyrosine (hydrate) (CHEBI:177941) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[(2-aminoacetyl)amino]-3-(4-hydroxyphenyl)propanoic acid;dihydrate |
| Manual Xrefs | Databases |
|---|---|
| 23621101 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:39630-46-1 | ChemIDplus |