EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12O5 |
| Net Charge | 0 |
| Average Mass | 212.201 |
| Monoisotopic Mass | 212.06847 |
| SMILES | COc1cc(C(O)CC(=O)O)ccc1O |
| InChI | InChI=1S/C10H12O5/c1-15-9-4-6(2-3-7(9)11)8(12)5-10(13)14/h2-4,8,11-12H,5H2,1H3,(H,13,14) |
| InChIKey | ABTZMSOARGMKMK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombyx mori (ncbitaxon:7091) | hemolymph (BTO:0000572) | Article |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxy-3-(4'-hydroxy-3'-methoxyphenyl)propionic acid (CHEBI:177935) is a benzenes (CHEBI:22712) |
| 3-hydroxy-3-(4'-hydroxy-3'-methoxyphenyl)propionic acid (CHEBI:177935) is a monocarboxylic acid (CHEBI:25384) |
| 3-hydroxy-3-(4'-hydroxy-3'-methoxyphenyl)propionic acid (CHEBI:177935) is conjugate acid of 3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoate (CHEBI:229973) |
| Incoming Relation(s) |
| 3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoate (CHEBI:229973) is conjugate base of 3-hydroxy-3-(4'-hydroxy-3'-methoxyphenyl)propionic acid (CHEBI:177935) |
| IUPAC Name |
|---|
| 3-hydroxy-3-(4-hydroxy-3-methoxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0133486 | HMDB |
| 32180255 | ChemSpider |