EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H32O |
| Net Charge | 0 |
| Average Mass | 252.442 |
| Monoisotopic Mass | 252.24532 |
| SMILES | [H]C(=O)CCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C17H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18/h9-10,17H,2-8,11-16H2,1H3/b10-9- |
| InChIKey | UZXKSNXOPFPOKK-KTKRTIGZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ulva pertusa (ncbitaxon:3120) | - | DOI (10.1007/s10811-011-9724-x) | |
| Zostera marina (ncbitaxon:29655) | - | DOI (10.1007/s13659-013-0043-6 ) |
| Roles Classification |
|---|
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8Z)-heptadecenal (CHEBI:177920) has role algal metabolite (CHEBI:84735) |
| (8Z)-heptadecenal (CHEBI:177920) has role marine metabolite (CHEBI:76507) |
| (8Z)-heptadecenal (CHEBI:177920) has role plant metabolite (CHEBI:76924) |
| (8Z)-heptadecenal (CHEBI:177920) is a 8-heptadecenal (CHEBI:168594) |
| IUPAC Name |
|---|
| (8Z)-heptadec-8-enal |
| Synonyms | Source |
|---|---|
| (Z)-8-heptadecenal | ChEBI |
| (8Z)-8-heptadecenal | ChEBI |
| (Z)-heptadec-8-enal | ChEBI |
| cis-8-heptadecenal | ChEBI |
| UniProt Name | Source |
|---|---|
| (8Z)-heptadecenal | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 4935449 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:56797-41-2 | ChEBI |
| Citations |
|---|