EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | [13C3]H4O3 |
| Net Charge | 0 |
| Average Mass | 91.039 |
| Monoisotopic Mass | 91.02611 |
| SMILES | [13CH3][13C](=O)[13C](=O)O |
| InChI | InChI=1S/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)/i1+1,2+1,3+1 |
| InChIKey | LCTONWCANYUPML-VMIGTVKRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyruvic-13C3 acid (CHEBI:177913) is a 13C-modified compound (CHEBI:139357) |
| Pyruvic-13C3 acid (CHEBI:177913) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 2-oxo(1,2,3-13C3)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8053017 | ChemSpider |