EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H56 |
| Net Charge | 0 |
| Average Mass | 536.888 |
| Monoisotopic Mass | 536.43820 |
| SMILES | CC(C)=CCC/C(C)=C\C=C\C(C)=C\C=C\C(C)=C\C=C\C=C(C)\C=C\C=C(C)\C=C\C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27-,38-28+,39-29+,40-30+ |
| InChIKey | OAIJSZIZWZSQBC-IKZLVQEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solanum lycopersicum (ncbitaxon:4081) | - | PubMed (22950575) | Species also known as Lycopersicon esculentum. |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-cis-lycopene (CHEBI:177905) has part carotenoid ψ-end derivative (CHEBI:139114) |
| 5-cis-lycopene (CHEBI:177905) has role antioxidant (CHEBI:22586) |
| 5-cis-lycopene (CHEBI:177905) has role plant metabolite (CHEBI:76924) |
| 5-cis-lycopene (CHEBI:177905) is a acyclic carotene (CHEBI:35162) |
| IUPAC Name |
|---|
| (5cis)-ψ,ψ-carotene |
| Synonyms | Source |
|---|---|
| (5Z)-ψ,ψ-carotene | ChEBI |
| (5Z)-lycopene | ChemIDplus |
| (6Z,8E,10E,12E,14E,16E,18E,20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10,12,14,16,18,20,22,24,26,30-tridecaene | IUPAC |
| UniProt Name | Source |
|---|---|
| 5-cis-lycopene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0002297 | HMDB |
| 9931680 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:101468-86-4 | ChemIDplus |
| Citations |
|---|