EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | [H][C@@]12CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C[C@@]1(C)CC[C@H]2C(=C)C |
| InChI | InChI=1S/C25H40/c1-19(2)23-16-18-25(6)17-15-22(5)12-8-10-20(3)9-7-11-21(4)13-14-24(23)25/h10-11,15,23-24H,1,7-9,12-14,16-18H2,2-6H3/b20-10+,21-11+,22-15+/t23-,24-,25-/m0/s1 |
| InChIKey | OOAGNDVPNQTUHH-HIZNCHJXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum higginsianum (ncbitaxon:80884) | - | PubMed (34257153) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| brassiteraene B (CHEBI:177901) has role fungal metabolite (CHEBI:76946) |
| brassiteraene B (CHEBI:177901) is a carbobicyclic compound (CHEBI:36785) |
| brassiteraene B (CHEBI:177901) is a polycyclic olefin (CHEBI:35714) |
| brassiteraene B (CHEBI:177901) is a sesterterpene (CHEBI:35192) |
| IUPAC Name |
|---|
| (3R,3aS,6E,10E,14E,16aR)-6,10,14,16a-tetramethyl-3-(prop-1-en-2-yl)-1,2,3,3a,4,5,8,9,12,13,16,16a-dodecahydrocyclopenta[15]annulene |
| Citations |
|---|