EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | [H][C@@]12CC/C(C)=C/CCC(=C)[C@@]1([H])C[C@@]2(C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C25H40/c1-19(2)10-7-11-20(3)13-9-17-25(6)18-23-22(5)14-8-12-21(4)15-16-24(23)25/h10,12-13,23-24H,5,7-9,11,14-18H2,1-4,6H3/b20-13+,21-12+/t23-,24-,25-/m1/s1 |
| InChIKey | KEWHXPJNBRKPIV-YCRSHSPUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsis fici (ncbitaxon:393283) | - | PubMed (34257153) | |
| Aspergillus clavatus (ncbitaxon:5057) | - | PubMed (23324037) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clavaphyllene (CHEBI:177894) has role Aspergillus metabolite (CHEBI:76956) |
| clavaphyllene (CHEBI:177894) has role fungal metabolite (CHEBI:76946) |
| clavaphyllene (CHEBI:177894) is a carbobicyclic compound (CHEBI:36785) |
| clavaphyllene (CHEBI:177894) is a polycyclic olefin (CHEBI:35714) |
| clavaphyllene (CHEBI:177894) is a sesterterpene (CHEBI:35192) |
| IUPAC Name |
|---|
| (1R,4E,9S,11R)-11-[(3E)-4,8-dimethylnona-3,7-dien-1-yl]-4,11-dimethyl-8-methylidenebicyclo[7.2.0]undec-4-ene |
| Citations |
|---|