EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H40 |
| Net Charge | 0 |
| Average Mass | 340.595 |
| Monoisotopic Mass | 340.31300 |
| SMILES | [H][C@]12C/C=C(C)/C=C/C/C(C)=C/CC/C(C)=C/C[C@]1(C)CC[C@H]2C(C)C |
| InChI | InChI=1S/C25H40/c1-19(2)23-16-18-25(6)17-15-22(5)12-8-10-20(3)9-7-11-21(4)13-14-24(23)25/h7,10-11,13,15,19,23-24H,8-9,12,14,16-18H2,1-6H3/b11-7+,20-10+,21-13+,22-15+/t23-,24+,25+/m0/s1 |
| InChIKey | HNQNDSZTKGSDTD-ZCDAFREASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Colletotrichum incanum (ncbitaxon:1573173) | - | PubMed (34257153) | |
| Colletotrichum orbiculare (ncbitaxon:5465) | - | PubMed (34257153) | |
| Colletotrichum gloeosporioides (ncbitaxon:474922) | - | PubMed (34257153) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sesterorbiculene (CHEBI:177886) has role fungal metabolite (CHEBI:76946) |
| sesterorbiculene (CHEBI:177886) is a carbobicyclic compound (CHEBI:36785) |
| sesterorbiculene (CHEBI:177886) is a polycyclic olefin (CHEBI:35714) |
| sesterorbiculene (CHEBI:177886) is a sesterterpene (CHEBI:35192) |
| IUPAC Name |
|---|
| (1S,3aS,5E,9E,12E,14E,16aR)-3a,6,10,14-tetramethyl-1-(propan-2-yl)-1,2,3,3a,4,7,8,11,16,16a-decahydrocyclopenta[15]annulene |
| Synonym | Source |
|---|---|
| (−)-sesterorbiculene | ChEBI |
| Citations |
|---|