EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11O7 |
| Net Charge | -3 |
| Average Mass | 231.180 |
| Monoisotopic Mass | 231.05212 |
| SMILES | O=C([O-])CCCC[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C9H14O7/c10-6(11)4-2-1-3-5(8(13)14)7(12)9(15)16/h5,7,12H,1-4H2,(H,10,11)(H,13,14)(H,15,16)/p-3/t5-,7+/m0/s1 |
| InChIKey | NLOCBSDWTSPKMJ-CAHLUQPWSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-threo-isotrihomocitrate(3−) (CHEBI:177881) is a tricarboxylic acid trianion (CHEBI:27092) |
| (−)-threo-isotrihomocitrate(3−) (CHEBI:177881) is conjugate base of 1-Hydroxyhexane-1,2,6-tricarboxylate (CHEBI:80595) |
| Incoming Relation(s) |
| 1-Hydroxyhexane-1,2,6-tricarboxylate (CHEBI:80595) is conjugate acid of (−)-threo-isotrihomocitrate(3−) (CHEBI:177881) |
| Synonym | Source |
|---|---|
| (2R,3S)-isotrihomocitrate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (2R,3S)-iso(homo)3citrate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-336 | MetaCyc |
| Citations |
|---|