EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H19N3O3S |
| Net Charge | 0 |
| Average Mass | 393.468 |
| Monoisotopic Mass | 393.11471 |
| SMILES | CS(=O)(=O)Nc1ccc2nc(Cc3ccc(Oc4ccccc4)cc3)nc2c1 |
| InChI | InChI=1S/C21H19N3O3S/c1-28(25,26)24-16-9-12-19-20(14-16)23-21(22-19)13-15-7-10-18(11-8-15)27-17-5-3-2-4-6-17/h2-12,14,24H,13H2,1H3,(H,22,23) |
| InChIKey | YOUFPIVQKJMXMT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-[2-(4-phenoxybenzyl)benzimidazol-5-yl]methanesulfonamide (CHEBI:177876) has role neuroprotective agent (CHEBI:63726) |
| N-[2-(4-phenoxybenzyl)benzimidazol-5-yl]methanesulfonamide (CHEBI:177876) has role NMDA receptor antagonist (CHEBI:60643) |
| N-[2-(4-phenoxybenzyl)benzimidazol-5-yl]methanesulfonamide (CHEBI:177876) is a aromatic ether (CHEBI:35618) |
| N-[2-(4-phenoxybenzyl)benzimidazol-5-yl]methanesulfonamide (CHEBI:177876) is a benzenes (CHEBI:22712) |
| N-[2-(4-phenoxybenzyl)benzimidazol-5-yl]methanesulfonamide (CHEBI:177876) is a benzimidazoles (CHEBI:22715) |
| N-[2-(4-phenoxybenzyl)benzimidazol-5-yl]methanesulfonamide (CHEBI:177876) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-[2-(4-phenoxybenzyl)-1H-benzimidazol-6-yl]methanesulfonamide |
| Synonyms | Source |
|---|---|
| N-[2-(4-phenoxybenzyl)benzimidazol-5-yl]methanesulphonamide | ChEBI |
| XK2 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| 8041057 | ChemSpider |
| WO2001032174 | Patent |
| Citations |
|---|